C31H43N3O3 — CID 142204888
2-[(2S)-1-[8-[4-(cyclohexa-1,5-dien-1-ylmethoxy)phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine (PubChem CID 142204888) has the molecular formula C31H43N3O3 and a molecular weight of 505.70 g/mol. Its IUPAC name is 2-[(2S)-1-[8-[4-(cyclohexa-1,5-dien-1-ylmethoxy)phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine.
| Compound Name | 2-[(2S)-1-[8-[4-(cyclohexa-1,5-dien-1-ylmethoxy)phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine |
|---|---|
| PubChem CID | 142204888 |
| Molecular Formula | C31H43N3O3 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | 2-[(2S)-1-[8-[4-(cyclohexa-1,5-dien-1-ylmethoxy)phenoxy]octoxy]-3-phenylpropan-2-yl]guanidine |
| SMILES | NC(N)=N[C@H](COCCCCCCCCOc1ccc(OCC2=CCCC=C2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H43N3O3/c32-31(33)34-28(23-26-13-7-5-8-14-26)25-35-21-11-3-1-2-4-12-22-36-29-17-19-30(20-18-29)37-24-27-15-9-6-10-16-27/h5,7-9,13-20,28H,1-4,6,10-12,21-25H2,(H4,32,33,34)/t28-/m0/s1 |
| InChIKey | FULDGXPWGQVQNS-NDEPHWFRSA-N |
| XLogP | 5.96 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|