C13H16O2S — CID 142205724
3,5-dimethyl-1-benzothiophene-2-carboxylic acid;ethane (PubChem CID 142205724) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is 3,5-dimethyl-1-benzothiophene-2-carboxylic acid;ethane.
| Compound Name | 3,5-dimethyl-1-benzothiophene-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142205724 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3,5-dimethyl-1-benzothiophene-2-carboxylic acid;ethane |
| SMILES | CC.Cc1ccc2sc(C(=O)O)c(C)c2c1 |
| InChI | InChI=1S/C11H10O2S.C2H6/c1-6-3-4-9-8(5-6)7(2)10(14-9)11(12)13;1-2/h3-5H,1-2H3,(H,12,13);1-2H3 |
| InChIKey | OPGZKFXDOTWYMB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |