C19H14N4O2S — CID 123631245
3-methyl-5-[pyridin-2-yl(pyrimidin-2-yl)amino]-1-benzothiophene-2-carboxylic acid (PubChem CID 123631245) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is 3-methyl-5-[pyridin-2-yl(pyrimidin-2-yl)amino]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-[pyridin-2-yl(pyrimidin-2-yl)amino]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 123631245 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-methyl-5-[pyridin-2-yl(pyrimidin-2-yl)amino]-1-benzothiophene-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)sc2ccc(N(c3ccccn3)c3ncccn3)cc12 |
| InChI | InChI=1S/C19H14N4O2S/c1-12-14-11-13(6-7-15(14)26-17(12)18(24)25)23(16-5-2-3-8-20-16)19-21-9-4-10-22-19/h2-11H,1H3,(H,24,25) |
| InChIKey | VPSSJKUJMSOBFF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |