C44H42N4 — CID 59194887
9,10-ditert-butyl-7-N,7-N-diphenyl-2-N,2-N-dipyridin-2-ylanthracene-2,7-diamine (PubChem CID 59194887) has the molecular formula C44H42N4 and a molecular weight of 626.85 g/mol. Its IUPAC name is 9,10-ditert-butyl-7-N,7-N-diphenyl-2-N,2-N-dipyridin-2-ylanthracene-2,7-diamine.
| Compound Name | 9,10-ditert-butyl-7-N,7-N-diphenyl-2-N,2-N-dipyridin-2-ylanthracene-2,7-diamine |
|---|---|
| PubChem CID | 59194887 |
| Molecular Formula | C44H42N4 |
| Molecular Weight | 626.85 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | 9,10-ditert-butyl-7-N,7-N-diphenyl-2-N,2-N-dipyridin-2-ylanthracene-2,7-diamine |
| SMILES | CC(C)(C)c1c2ccc(N(c3ccccc3)c3ccccc3)cc2c(C(C)(C)C)c2cc(N(c3ccccn3)c3ccccn3)ccc12 |
| InChI | InChI=1S/C44H42N4/c1-43(2,3)41-35-25-23-33(47(31-17-9-7-10-18-31)32-19-11-8-12-20-32)29-37(35)42(44(4,5)6)38-30-34(24-26-36(38)41)48(39-21-13-15-27-45-39)40-22-14-16-28-46-40/h7-30H,1-6H3 |
| InChIKey | NREHRZABHBOCLA-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.85 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|