C24H30Cl2N2OS — CID 10298554
3-(4-benzylpiperazin-1-yl)-1-(3,5-dimethyl-1-benzothiophen-2-yl)propan-1-one;dihydrochloride (PubChem CID 10298554) has the molecular formula C24H30Cl2N2OS and a molecular weight of 465.49 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-1-(3,5-dimethyl-1-benzothiophen-2-yl)propan-1-one;dihydrochloride.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-1-(3,5-dimethyl-1-benzothiophen-2-yl)propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 10298554 |
| Molecular Formula | C24H30Cl2N2OS |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-1-(3,5-dimethyl-1-benzothiophen-2-yl)propan-1-one;dihydrochloride |
| SMILES | Cc1ccc2sc(C(=O)CCN3CCN(Cc4ccccc4)CC3)c(C)c2c1.Cl.Cl |
| InChI | InChI=1S/C24H28N2OS.2ClH/c1-18-8-9-23-21(16-18)19(2)24(28-23)22(27)10-11-25-12-14-26(15-13-25)17-20-6-4-3-5-7-20;;/h3-9,16H,10-15,17H2,1-2H3;2*1H |
| InChIKey | CDSRMZNCHCLEDM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_thiophene(3)', 'substructure': 'N/A'} |
|---|