C25H30N2O2S — CID 56976032
3-[[2-(1-benzylpiperidin-4-yl)ethylamino]methyl]-5-methyl-1-benzothiophene-2-carboxylic acid (PubChem CID 56976032) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is 3-[[2-(1-benzylpiperidin-4-yl)ethylamino]methyl]-5-methyl-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-[[2-(1-benzylpiperidin-4-yl)ethylamino]methyl]-5-methyl-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 56976032 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-[[2-(1-benzylpiperidin-4-yl)ethylamino]methyl]-5-methyl-1-benzothiophene-2-carboxylic acid |
| SMILES | Cc1ccc2sc(C(=O)O)c(CNCCC3CCN(Cc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C25H30N2O2S/c1-18-7-8-23-21(15-18)22(24(30-23)25(28)29)16-26-12-9-19-10-13-27(14-11-19)17-20-5-3-2-4-6-20/h2-8,15,19,26H,9-14,16-17H2,1H3,(H,28,29) |
| InChIKey | YOGZBTFHELSWTK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|