C14H17NS — CID 142206857
(4-ethylcyclohepta-1,3,5,6-tetraen-1-yl) N-[(Z)-prop-1-enyl]ethanimidothioate (PubChem CID 142206857) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is (4-ethylcyclohepta-1,3,5,6-tetraen-1-yl) N-[(Z)-prop-1-enyl]ethanimidothioate.
| Compound Name | (4-ethylcyclohepta-1,3,5,6-tetraen-1-yl) N-[(Z)-prop-1-enyl]ethanimidothioate |
|---|---|
| PubChem CID | 142206857 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (4-ethylcyclohepta-1,3,5,6-tetraen-1-yl) N-[(Z)-prop-1-enyl]ethanimidothioate |
| SMILES | C/C=C\N=C(/C)SC1=CC=C(CC)C=C=C1 |
| InChI | InChI=1S/C14H17NS/c1-4-11-15-12(3)16-14-8-6-7-13(5-2)9-10-14/h4,7-11H,5H2,1-3H3/b11-4-,15-12+ |
| InChIKey | QEMQTMNWWGXSOQ-RSKDGHDKSA-N |
| XLogP | 4.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|