C10H14N2O2 — CID 142207397
1-(5-methoxycyclohepta-1,4,6-trien-1-yl)-3-methylurea (PubChem CID 142207397) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(5-methoxycyclohepta-1,4,6-trien-1-yl)-3-methylurea.
| Compound Name | 1-(5-methoxycyclohepta-1,4,6-trien-1-yl)-3-methylurea |
|---|---|
| PubChem CID | 142207397 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(5-methoxycyclohepta-1,4,6-trien-1-yl)-3-methylurea |
| SMILES | CNC(=O)NC1=CCC=C(OC)C=C1 |
| InChI | InChI=1S/C10H14N2O2/c1-11-10(13)12-8-4-3-5-9(14-2)7-6-8/h4-7H,3H2,1-2H3,(H2,11,12,13) |
| InChIKey | TWALIDQKOJZQKW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |