C9H11NO2 — CID 143165803
N-(4-methoxycyclohepta-1,3,5-trien-1-yl)formamide (PubChem CID 143165803) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is N-(4-methoxycyclohepta-1,3,5-trien-1-yl)formamide.
| Compound Name | N-(4-methoxycyclohepta-1,3,5-trien-1-yl)formamide |
|---|---|
| PubChem CID | 143165803 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N-(4-methoxycyclohepta-1,3,5-trien-1-yl)formamide |
| SMILES | COC1=CC=C(NC=O)CC=C1 |
| InChI | InChI=1S/C9H11NO2/c1-12-9-4-2-3-8(5-6-9)10-7-11/h2,4-7H,3H2,1H3,(H,10,11) |
| InChIKey | NTVXZSGYPIFWMP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|