C10H10F3NO2 — CID 143007857
N-[5-methoxy-6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]formamide (PubChem CID 143007857) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is N-[5-methoxy-6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]formamide.
| Compound Name | N-[5-methoxy-6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]formamide |
|---|---|
| PubChem CID | 143007857 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-[5-methoxy-6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]formamide |
| SMILES | COC1=CCC=C(NC=O)C=C1C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2/c1-16-9-4-2-3-7(14-6-15)5-8(9)10(11,12)13/h3-6H,2H2,1H3,(H,14,15) |
| InChIKey | BBRMGUJIFSBYOD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|