C10H13NO2 — CID 142032408
N-(4-ethoxycyclohepta-1,3,5-trien-1-yl)formamide (PubChem CID 142032408) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is N-(4-ethoxycyclohepta-1,3,5-trien-1-yl)formamide.
| Compound Name | N-(4-ethoxycyclohepta-1,3,5-trien-1-yl)formamide |
|---|---|
| PubChem CID | 142032408 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-(4-ethoxycyclohepta-1,3,5-trien-1-yl)formamide |
| SMILES | CCOC1=CC=C(NC=O)CC=C1 |
| InChI | InChI=1S/C10H13NO2/c1-2-13-10-5-3-4-9(6-7-10)11-8-12/h3,5-8H,2,4H2,1H3,(H,11,12) |
| InChIKey | ZEMQXHDJPCZIQF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|