C13H23NO2 — CID 143108235
N-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]formamide;propane (PubChem CID 143108235) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is N-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]formamide;propane.
| Compound Name | N-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]formamide;propane |
|---|---|
| PubChem CID | 143108235 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]formamide;propane |
| SMILES | C/C=C(\C=C/C(=C\C)OC)NC=O.CCC |
| InChI | InChI=1S/C10H15NO2.C3H8/c1-4-9(11-8-12)6-7-10(5-2)13-3;1-3-2/h4-8H,1-3H3,(H,11,12);3H2,1-2H3/b7-6-,9-4+,10-5+; |
| InChIKey | KPEVLZRENDNWQR-RSQQIKCUSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|