C21H33N3O3 — CID 143307531
1-[5-[(2E,5Z)-7-aminohepta-2,5-dien-3-yl]oxy-4-methoxycyclohepta-1,4,6-trien-1-yl]-3-pentan-3-ylurea (PubChem CID 143307531) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-[5-[(2E,5Z)-7-aminohepta-2,5-dien-3-yl]oxy-4-methoxycyclohepta-1,4,6-trien-1-yl]-3-pentan-3-ylurea.
| Compound Name | 1-[5-[(2E,5Z)-7-aminohepta-2,5-dien-3-yl]oxy-4-methoxycyclohepta-1,4,6-trien-1-yl]-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 143307531 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 1-[5-[(2E,5Z)-7-aminohepta-2,5-dien-3-yl]oxy-4-methoxycyclohepta-1,4,6-trien-1-yl]-3-pentan-3-ylurea |
| SMILES | C/C=C(\C/C=C\CN)OC1=C(OC)CC=C(NC(=O)NC(CC)CC)C=C1 |
| InChI | InChI=1S/C21H33N3O3/c1-5-16(6-2)23-21(25)24-17-11-13-19(26-4)20(14-12-17)27-18(7-3)10-8-9-15-22/h7-9,11-12,14,16H,5-6,10,13,15,22H2,1-4H3,(H2,23,24,25)/b9-8-,18-7+ |
| InChIKey | MYYJVLRDESLUMN-VUVDDXAYSA-N |
| XLogP | 4.00 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|