C24H37N3O2 — CID 143307535
1-[(2Z,7E)-7-[(5-aminocyclohepta-1,4,6-trien-1-yl)oxymethylidene]deca-2,4-dien-4-yl]-3-pentan-3-ylurea (PubChem CID 143307535) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 1-[(2Z,7E)-7-[(5-aminocyclohepta-1,4,6-trien-1-yl)oxymethylidene]deca-2,4-dien-4-yl]-3-pentan-3-ylurea.
| Compound Name | 1-[(2Z,7E)-7-[(5-aminocyclohepta-1,4,6-trien-1-yl)oxymethylidene]deca-2,4-dien-4-yl]-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 143307535 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 1-[(2Z,7E)-7-[(5-aminocyclohepta-1,4,6-trien-1-yl)oxymethylidene]deca-2,4-dien-4-yl]-3-pentan-3-ylurea |
| SMILES | C/C=C\C(=CC/C(=C/OC1=CCC=C(N)C=C1)CCC)NC(=O)NC(CC)CC |
| InChI | InChI=1S/C24H37N3O2/c1-5-10-19(18-29-23-13-9-12-20(25)15-17-23)14-16-22(11-6-2)27-24(28)26-21(7-3)8-4/h6,11-13,15-18,21H,5,7-10,14,25H2,1-4H3,(H2,26,27,28)/b11-6-,19-18+,22-16? |
| InChIKey | GLBXAXAAYVLXPS-AFBSJESBSA-N |
| XLogP | 5.71 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|