About molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide
molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 142207701) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide.
Analyze molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide (CID 142207701) is molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide is CC(=O)Nc1nc(C(C)C)cs1.[H][H].
What is the InChIKey of molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide?
The InChIKey is XVKMGHIXZXLGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS.H2/c1-5(2)7-4-12-8(10-7)9-6(3)11;/h4-5H,1-3H3,(H,9,10,11);1H.
What are the key properties of molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide?
molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide has a molecular weight of 186.28 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 142207701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).