C27H30ClN5O3S — CID 142209603
5-chloro-N-[1,3-dioxo-2-[[1-[C-[(Z)-prop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-1,4-diazocan-5-yl]methyl]isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 142209603) has the molecular formula C27H30ClN5O3S and a molecular weight of 540.09 g/mol. Its IUPAC name is 5-chloro-N-[1,3-dioxo-2-[[1-[C-[(Z)-prop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-1,4-diazocan-5-yl]methyl]isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[1,3-dioxo-2-[[1-[C-[(Z)-prop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-1,4-diazocan-5-yl]methyl]isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 142209603 |
| Molecular Formula | C27H30ClN5O3S |
| Molecular Weight | 540.09 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 5-chloro-N-[1,3-dioxo-2-[[1-[C-[(Z)-prop-1-enyl]-N-prop-1-en-2-ylcarbonimidoyl]-1,4-diazocan-5-yl]methyl]isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | C=C(C)/N=C(/C=C\C)N1CCCC(CN2C(=O)c3cccc(NC(=O)c4ccc(Cl)s4)c3C2=O)NCC1 |
| InChI | InChI=1S/C27H30ClN5O3S/c1-4-7-23(30-17(2)3)32-14-6-8-18(29-13-15-32)16-33-26(35)19-9-5-10-20(24(19)27(33)36)31-25(34)21-11-12-22(28)37-21/h4-5,7,9-12,18,29H,2,6,8,13-16H2,1,3H3,(H,31,34)/b7-4-,30-23- |
| InChIKey | JGTOSOGWPWXZPT-MDAFDSTKSA-N |
| XLogP | 4.81 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.09 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|