C21H18ClN5O3S2 — CID 142210819
1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-[7-(ethylamino)-4-oxoquinazolin-3-yl]phenyl]urea (PubChem CID 142210819) has the molecular formula C21H18ClN5O3S2 and a molecular weight of 487.99 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-[7-(ethylamino)-4-oxoquinazolin-3-yl]phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-[7-(ethylamino)-4-oxoquinazolin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 142210819 |
| Molecular Formula | C21H18ClN5O3S2 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfinyl-3-[4-[7-(ethylamino)-4-oxoquinazolin-3-yl]phenyl]urea |
| SMILES | CCNc1ccc2c(=O)n(-c3ccc(NC(=O)NS(=O)c4ccc(Cl)s4)cc3)cnc2c1 |
| InChI | InChI=1S/C21H18ClN5O3S2/c1-2-23-14-5-8-16-17(11-14)24-12-27(20(16)28)15-6-3-13(4-7-15)25-21(29)26-32(30)19-10-9-18(22)31-19/h3-12,23H,2H2,1H3,(H2,25,26,29) |
| InChIKey | MFIJBLLKSNZDAO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |