C24H34N6O2S — CID 142211251
N-[3-[[3-[N-(2,5-diaminopentylidene)carbamimidoyl]phenyl]sulfanylamino]phenyl]-1-methylcyclopropane-1-carboxamide;methanol (PubChem CID 142211251) has the molecular formula C24H34N6O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-[3-[[3-[N-(2,5-diaminopentylidene)carbamimidoyl]phenyl]sulfanylamino]phenyl]-1-methylcyclopropane-1-carboxamide;methanol.
| Compound Name | N-[3-[[3-[N-(2,5-diaminopentylidene)carbamimidoyl]phenyl]sulfanylamino]phenyl]-1-methylcyclopropane-1-carboxamide;methanol |
|---|---|
| PubChem CID | 142211251 |
| Molecular Formula | C24H34N6O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | N-[3-[[3-[N-(2,5-diaminopentylidene)carbamimidoyl]phenyl]sulfanylamino]phenyl]-1-methylcyclopropane-1-carboxamide;methanol |
| SMILES | CO.[H]/N=C(\N=C\C(N)CCCN)c1cccc(SNc2cccc(NC(=O)C3(C)CC3)c2)c1 |
| InChI | InChI=1S/C23H30N6OS.CH4O/c1-23(10-11-23)22(30)28-18-7-3-8-19(14-18)29-31-20-9-2-5-16(13-20)21(26)27-15-17(25)6-4-12-24;1-2/h2-3,5,7-9,13-15,17,26,29H,4,6,10-12,24-25H2,1H3,(H,28,30);2H,1H3/b26-21-,27-15+; |
| InChIKey | KCLOYDWTGRWZPQ-VVHZDKHWSA-N |
| XLogP | 3.62 |
| TPSA | 149.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|