C45H46O3S2 — CID 142211752
1-(4-butoxyphenyl)sulfanyl-5-[(2E,5Z)-7-[4-(4-methylcyclohexyl)phenyl]octa-2,5,7-trien-3-yl]sulfanylanthracene-9,10-dione (PubChem CID 142211752) has the molecular formula C45H46O3S2 and a molecular weight of 698.99 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)sulfanyl-5-[(2E,5Z)-7-[4-(4-methylcyclohexyl)phenyl]octa-2,5,7-trien-3-yl]sulfanylanthracene-9,10-dione.
| Compound Name | 1-(4-butoxyphenyl)sulfanyl-5-[(2E,5Z)-7-[4-(4-methylcyclohexyl)phenyl]octa-2,5,7-trien-3-yl]sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 142211752 |
| Molecular Formula | C45H46O3S2 |
| Molecular Weight | 698.99 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | 1-(4-butoxyphenyl)sulfanyl-5-[(2E,5Z)-7-[4-(4-methylcyclohexyl)phenyl]octa-2,5,7-trien-3-yl]sulfanylanthracene-9,10-dione |
| SMILES | C=C(/C=C\C/C(=C\C)Sc1cccc2c1C(=O)c1cccc(Sc3ccc(OCCCC)cc3)c1C2=O)c1ccc(C2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C45H46O3S2/c1-5-7-29-48-35-25-27-37(28-26-35)50-41-16-10-14-39-43(41)45(47)38-13-9-15-40(42(38)44(39)46)49-36(6-2)12-8-11-31(4)32-21-23-34(24-22-32)33-19-17-30(3)18-20-33/h6,8-11,13-16,21-28,30,33H,4-5,7,12,17-20,29H2,1-3H3/b11-8-,36-6+ |
| InChIKey | CVBIMUQURUYVQF-FGDFFWCMSA-N |
| XLogP | 12.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.99 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|