C27H40ClN3O4S — CID 142212520
[1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-3-yl] N-butyl-N-[3-(methylamino)propyl]carbamate;propane (PubChem CID 142212520) has the molecular formula C27H40ClN3O4S and a molecular weight of 538.15 g/mol. Its IUPAC name is [1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-3-yl] N-butyl-N-[3-(methylamino)propyl]carbamate;propane.
| Compound Name | [1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-3-yl] N-butyl-N-[3-(methylamino)propyl]carbamate;propane |
|---|---|
| PubChem CID | 142212520 |
| Molecular Formula | C27H40ClN3O4S |
| Molecular Weight | 538.15 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | [1-(4-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-3-yl] N-butyl-N-[3-(methylamino)propyl]carbamate;propane |
| SMILES | CCC.CCCCN(CCCNC)C(=O)OC1Cc2ccccc2N(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H32ClN3O4S.C3H8/c1-3-4-15-27(16-7-14-26-2)24(29)32-21-17-19-8-5-6-9-23(19)28(18-21)33(30,31)22-12-10-20(25)11-13-22;1-3-2/h5-6,8-13,21,26H,3-4,7,14-18H2,1-2H3;3H2,1-2H3 |
| InChIKey | JDRKJBDFEPACGU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.15 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|