C34H46N2O3S — CID 142213463
(E)-2-methylbut-2-enoic acid;N-[1-[3-methyl-5-[(2-methylphenyl)methoxy]phenyl]ethenyl]prop-1-en-2-amine;4-methyl-5-pentyl-1,3-thiazole (PubChem CID 142213463) has the molecular formula C34H46N2O3S and a molecular weight of 562.82 g/mol. Its IUPAC name is (E)-2-methylbut-2-enoic acid;N-[1-[3-methyl-5-[(2-methylphenyl)methoxy]phenyl]ethenyl]prop-1-en-2-amine;4-methyl-5-pentyl-1,3-thiazole.
| Compound Name | (E)-2-methylbut-2-enoic acid;N-[1-[3-methyl-5-[(2-methylphenyl)methoxy]phenyl]ethenyl]prop-1-en-2-amine;4-methyl-5-pentyl-1,3-thiazole |
|---|---|
| PubChem CID | 142213463 |
| Molecular Formula | C34H46N2O3S |
| Molecular Weight | 562.82 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | (E)-2-methylbut-2-enoic acid;N-[1-[3-methyl-5-[(2-methylphenyl)methoxy]phenyl]ethenyl]prop-1-en-2-amine;4-methyl-5-pentyl-1,3-thiazole |
| SMILES | C/C=C(\C)C(=O)O.C=C(C)NC(=C)c1cc(C)cc(OCc2ccccc2C)c1.CCCCCc1scnc1C |
| InChI | InChI=1S/C20H23NO.C9H15NS.C5H8O2/c1-14(2)21-17(5)19-10-15(3)11-20(12-19)22-13-18-9-7-6-8-16(18)4;1-3-4-5-6-9-8(2)10-7-11-9;1-3-4(2)5(6)7/h6-12,21H,1,5,13H2,2-4H3;7H,3-6H2,1-2H3;3H,1-2H3,(H,6,7)/b;;4-3+ |
| InChIKey | YZAJIYQLFJUHCP-VJJINTEWSA-N |
| XLogP | 9.20 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.82 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|