C25H28O7 — CID 142214635
2-[[3-[3-[(7-acetyl-2,3-dihydro-1-benzofuran-5-yl)oxy]propoxy]phenyl]methyl]oxolane-2-carboxylic acid (PubChem CID 142214635) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is 2-[[3-[3-[(7-acetyl-2,3-dihydro-1-benzofuran-5-yl)oxy]propoxy]phenyl]methyl]oxolane-2-carboxylic acid.
| Compound Name | 2-[[3-[3-[(7-acetyl-2,3-dihydro-1-benzofuran-5-yl)oxy]propoxy]phenyl]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 142214635 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[[3-[3-[(7-acetyl-2,3-dihydro-1-benzofuran-5-yl)oxy]propoxy]phenyl]methyl]oxolane-2-carboxylic acid |
| SMILES | CC(=O)c1cc(OCCCOc2cccc(CC3(C(=O)O)CCCO3)c2)cc2c1OCC2 |
| InChI | InChI=1S/C25H28O7/c1-17(26)22-15-21(14-19-7-12-31-23(19)22)30-10-4-9-29-20-6-2-5-18(13-20)16-25(24(27)28)8-3-11-32-25/h2,5-6,13-15H,3-4,7-12,16H2,1H3,(H,27,28) |
| InChIKey | RVLKJHMPKAKKPU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|