C23H26ClNO5 — CID 59712431
2-[[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]phenyl]methyl]oxolane-2-carboxylic acid (PubChem CID 59712431) has the molecular formula C23H26ClNO5 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-[[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]phenyl]methyl]oxolane-2-carboxylic acid.
| Compound Name | 2-[[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]phenyl]methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 59712431 |
| Molecular Formula | C23H26ClNO5 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[[3-[[(2-chloro-4-propoxybenzoyl)amino]methyl]phenyl]methyl]oxolane-2-carboxylic acid |
| SMILES | CCCOc1ccc(C(=O)NCc2cccc(CC3(C(=O)O)CCCO3)c2)c(Cl)c1 |
| InChI | InChI=1S/C23H26ClNO5/c1-2-10-29-18-7-8-19(20(24)13-18)21(26)25-15-17-6-3-5-16(12-17)14-23(22(27)28)9-4-11-30-23/h3,5-8,12-13H,2,4,9-11,14-15H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | MDRPLBAZZZGYOS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |