C21H34OS2 — CID 142215540
[(3R)-4-(2-ethyl-1-methyl-3-sulfanyloxycyclohexyl)-3-methylpentyl]sulfanylbenzene (PubChem CID 142215540) has the molecular formula C21H34OS2 and a molecular weight of 366.64 g/mol. Its IUPAC name is [(3R)-4-(2-ethyl-1-methyl-3-sulfanyloxycyclohexyl)-3-methylpentyl]sulfanylbenzene.
| Compound Name | [(3R)-4-(2-ethyl-1-methyl-3-sulfanyloxycyclohexyl)-3-methylpentyl]sulfanylbenzene |
|---|---|
| PubChem CID | 142215540 |
| Molecular Formula | C21H34OS2 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | [(3R)-4-(2-ethyl-1-methyl-3-sulfanyloxycyclohexyl)-3-methylpentyl]sulfanylbenzene |
| SMILES | CCC1C(OS)CCCC1(C)C(C)[C@H](C)CCSc1ccccc1 |
| InChI | InChI=1S/C21H34OS2/c1-5-19-20(22-23)12-9-14-21(19,4)17(3)16(2)13-15-24-18-10-7-6-8-11-18/h6-8,10-11,16-17,19-20,23H,5,9,12-15H2,1-4H3/t16-,17?,19?,20?,21?/m1/s1 |
| InChIKey | AHKDHHILQAXCGE-HITIYHHRSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|