C12H15NO2 — CID 142216290
(Z)-3-(benzylideneamino)pent-3-ene-1,4-diol (PubChem CID 142216290) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (Z)-3-(benzylideneamino)pent-3-ene-1,4-diol.
| Compound Name | (Z)-3-(benzylideneamino)pent-3-ene-1,4-diol |
|---|---|
| PubChem CID | 142216290 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (Z)-3-(benzylideneamino)pent-3-ene-1,4-diol |
| SMILES | C/C(O)=C(CCO)/N=C/c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-10(15)12(7-8-14)13-9-11-5-3-2-4-6-11/h2-6,9,14-15H,7-8H2,1H3/b12-10-,13-9+ |
| InChIKey | WKRRUHAWUZKPQG-NBGAZXPKSA-N |
| XLogP | 2.28 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|