C21H27N9 — CID 142217395
4-(aminomethyl)-N'-[2-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]hydrazinyl]benzenecarboximidamide (PubChem CID 142217395) has the molecular formula C21H27N9 and a molecular weight of 405.51 g/mol. Its IUPAC name is 4-(aminomethyl)-N'-[2-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]hydrazinyl]benzenecarboximidamide.
| Compound Name | 4-(aminomethyl)-N'-[2-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]hydrazinyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142217395 |
| Molecular Formula | C21H27N9 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 4-(aminomethyl)-N'-[2-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]hydrazinyl]benzenecarboximidamide |
| SMILES | CC(C)(C)Cn1c(CNN/N=C(\N)c2ccc(CN)cc2)cc2cnc(C#N)nc21 |
| InChI | InChI=1S/C21H27N9/c1-21(2,3)13-30-17(8-16-11-25-18(10-23)27-20(16)30)12-26-29-28-19(24)15-6-4-14(9-22)5-7-15/h4-8,11,26,29H,9,12-13,22H2,1-3H3,(H2,24,28) |
| InChIKey | BPZGQJTVFDEQEW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|