C18H26N8 — CID 59834686
4-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]piperazine-1-carboximidamide (PubChem CID 59834686) has the molecular formula C18H26N8 and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59834686 |
| Molecular Formula | C18H26N8 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 4-[[2-cyano-7-(2,2-dimethylpropyl)pyrrolo[2,3-d]pyrimidin-6-yl]methyl]piperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(Cc2cc3cnc(C#N)nc3n2CC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H26N8/c1-18(2,3)12-26-14(8-13-10-22-15(9-19)23-16(13)26)11-24-4-6-25(7-5-24)17(20)21/h8,10H,4-7,11-12H2,1-3H3,(H3,20,21) |
| InChIKey | UJHSNWSGTOEURH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|