C21H18N6O4 — CID 59834688
7-(2,2-dimethylpropyl)-6-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile (PubChem CID 59834688) has the molecular formula C21H18N6O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-6-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile.
| Compound Name | 7-(2,2-dimethylpropyl)-6-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 59834688 |
| Molecular Formula | C21H18N6O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-6-[(5-nitro-1,3-dioxoisoindol-2-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
| SMILES | CC(C)(C)Cn1c(CN2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)cc2cnc(C#N)nc21 |
| InChI | InChI=1S/C21H18N6O4/c1-21(2,3)11-26-14(6-12-9-23-17(8-22)24-18(12)26)10-25-19(28)15-5-4-13(27(30)31)7-16(15)20(25)29/h4-7,9H,10-11H2,1-3H3 |
| InChIKey | KWEBGGDLFYFQBK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 135.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|