About N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene
N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene (PubChem CID 142217474) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene.
Molecular Properties
| Compound Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene |
| PubChem CID | 142217474 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene |
| SMILES | C=C/C(=C\N=C)NC(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C7H10N2O.C7H8/c1-4-7(5-8-3)9-6(2)10;1-7-5-3-2-4-6-7/h4-5H,1,3H2,2H3,(H,9,10);2-6H,1H3/b7-5+; |
| InChIKey | XQRVQXRKXQYUST-GZOLSCHFSA-N |
| XLogP | 2.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene?
The IUPAC name of N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene (CID 142217474) is N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene.
What is the SMILES notation for N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene?
The canonical SMILES for N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene is C=C/C(=C\N=C)NC(C)=O.Cc1ccccc1.
What is the InChIKey of N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene?
The InChIKey is XQRVQXRKXQYUST-GZOLSCHFSA-N. The full InChI is InChI=1S/C7H10N2O.C7H8/c1-4-7(5-8-3)9-6(2)10;1-7-5-3-2-4-6-7/h4-5H,1,3H2,2H3,(H,9,10);2-6H,1H3/b7-5+;.
What are the key properties of N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene?
N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene has a molecular weight of 230.31 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene is sourced from PubChem (CID 142217474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).