C14H18N2O — CID 142217474
N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene (PubChem CID 142217474) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene.
| Compound Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene |
|---|---|
| PubChem CID | 142217474 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide;toluene |
| SMILES | C=C/C(=C\N=C)NC(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C7H10N2O.C7H8/c1-4-7(5-8-3)9-6(2)10;1-7-5-3-2-4-6-7/h4-5H,1,3H2,2H3,(H,9,10);2-6H,1H3/b7-5+; |
| InChIKey | XQRVQXRKXQYUST-GZOLSCHFSA-N |
| XLogP | 2.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|