C7H10N2O — CID 142217475
N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide (PubChem CID 142217475) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide.
| Compound Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 142217475 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]acetamide |
| SMILES | C=C/C(=C\N=C)NC(C)=O |
| InChI | InChI=1S/C7H10N2O/c1-4-7(5-8-3)9-6(2)10/h4-5H,1,3H2,2H3,(H,9,10)/b7-5+ |
| InChIKey | WMBCZFDVBQYZNK-FNORWQNLSA-N |
| XLogP | 0.85 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|