C8H12N2O — CID 144540773
N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]propanamide (PubChem CID 144540773) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]propanamide.
| Compound Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]propanamide |
|---|---|
| PubChem CID | 144540773 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-[(1E)-1-(methylideneamino)buta-1,3-dien-2-yl]propanamide |
| SMILES | C=C/C(=C\N=C)NC(=O)CC |
| InChI | InChI=1S/C8H12N2O/c1-4-7(6-9-3)10-8(11)5-2/h4,6H,1,3,5H2,2H3,(H,10,11)/b7-6+ |
| InChIKey | DQGCZZGXUGMRCA-VOTSOKGWSA-N |
| XLogP | 1.24 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|