C10H16N2O — CID 147432203
N-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide (PubChem CID 147432203) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide.
| Compound Name | N-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide |
|---|---|
| PubChem CID | 147432203 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[(1E,3Z)-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide |
| SMILES | C=N/C=C(\C=C/C)NC(=O)CCC |
| InChI | InChI=1S/C10H16N2O/c1-4-6-9(8-11-3)12-10(13)7-5-2/h4,6,8H,3,5,7H2,1-2H3,(H,12,13)/b6-4-,9-8+ |
| InChIKey | DUOIHEZEMXTWQS-LJWGDIBWSA-N |
| XLogP | 2.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|