C10H16N2O — CID 142136380
4-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]butanamide (PubChem CID 142136380) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]butanamide.
| Compound Name | 4-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]butanamide |
|---|---|
| PubChem CID | 142136380 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-amino-N-[(3E)-hexa-1,3,5-trien-3-yl]butanamide |
| SMILES | C=C/C=C(\C=C)NC(=O)CCCN |
| InChI | InChI=1S/C10H16N2O/c1-3-6-9(4-2)12-10(13)7-5-8-11/h3-4,6H,1-2,5,7-8,11H2,(H,12,13)/b9-6+ |
| InChIKey | OLMSDPOEADCZNA-RMKNXTFCSA-N |
| XLogP | 1.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|