C13H22N2O — CID 143096497
6-amino-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]hexanamide (PubChem CID 143096497) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 6-amino-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]hexanamide.
| Compound Name | 6-amino-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]hexanamide |
|---|---|
| PubChem CID | 143096497 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 6-amino-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]hexanamide |
| SMILES | C=C/C=C(\C=C/C)NC(=O)CCCCCN |
| InChI | InChI=1S/C13H22N2O/c1-3-8-12(9-4-2)15-13(16)10-6-5-7-11-14/h3-4,8-9H,1,5-7,10-11,14H2,2H3,(H,15,16)/b9-4-,12-8+ |
| InChIKey | GEYOUMBSCUYISS-FIOFKEMQSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|