C15H23FN2O — CID 142246776
1-[(2E,4E,6E)-2-fluoro-7-(methylamino)octa-2,4,6-trien-4-yl]azepan-2-one (PubChem CID 142246776) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-[(2E,4E,6E)-2-fluoro-7-(methylamino)octa-2,4,6-trien-4-yl]azepan-2-one.
| Compound Name | 1-[(2E,4E,6E)-2-fluoro-7-(methylamino)octa-2,4,6-trien-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 142246776 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-[(2E,4E,6E)-2-fluoro-7-(methylamino)octa-2,4,6-trien-4-yl]azepan-2-one |
| SMILES | CN/C(C)=C/C=C(\C=C(/C)F)N1CCCCCC1=O |
| InChI | InChI=1S/C15H23FN2O/c1-12(16)11-14(9-8-13(2)17-3)18-10-6-4-5-7-15(18)19/h8-9,11,17H,4-7,10H2,1-3H3/b12-11+,13-8+,14-9+ |
| InChIKey | BIPZBRNBBRMXKM-MJPPZECFSA-N |
| XLogP | 3.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|