C14H26N2O — CID 142946544
N-ethyl-N-[(2E)-penta-2,4-dien-2-yl]butanamide;prop-2-en-1-amine (PubChem CID 142946544) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is N-ethyl-N-[(2E)-penta-2,4-dien-2-yl]butanamide;prop-2-en-1-amine.
| Compound Name | N-ethyl-N-[(2E)-penta-2,4-dien-2-yl]butanamide;prop-2-en-1-amine |
|---|---|
| PubChem CID | 142946544 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N-ethyl-N-[(2E)-penta-2,4-dien-2-yl]butanamide;prop-2-en-1-amine |
| SMILES | C=C/C=C(\C)N(CC)C(=O)CCC.C=CCN |
| InChI | InChI=1S/C11H19NO.C3H7N/c1-5-8-10(4)12(7-3)11(13)9-6-2;1-2-3-4/h5,8H,1,6-7,9H2,2-4H3;2H,1,3-4H2/b10-8+; |
| InChIKey | INXNOPQNNOSTRO-VRTOBVRTSA-N |
| XLogP | 2.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|