C15H29NO — CID 143705055
ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]butanamide (PubChem CID 143705055) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]butanamide.
| Compound Name | ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]butanamide |
|---|---|
| PubChem CID | 143705055 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | ethane;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]butanamide |
| SMILES | C=C/C=C(\C=C/C)NC(=O)CCC.CC.CC |
| InChI | InChI=1S/C11H17NO.2C2H6/c1-4-7-10(8-5-2)12-11(13)9-6-3;2*1-2/h4-5,7-8H,1,6,9H2,2-3H3,(H,12,13);2*1-2H3/b8-5-,10-7+;; |
| InChIKey | XBXZKBJCQHOQKX-QCQLBQLSSA-N |
| XLogP | 4.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|