C9H13FN2O — CID 170583184
N-[(1Z,3Z)-1-fluoro-1-(methylideneamino)penta-1,3-dien-2-yl]propanamide (PubChem CID 170583184) has the molecular formula C9H13FN2O and a molecular weight of 184.21 g/mol. Its IUPAC name is N-[(1Z,3Z)-1-fluoro-1-(methylideneamino)penta-1,3-dien-2-yl]propanamide.
| Compound Name | N-[(1Z,3Z)-1-fluoro-1-(methylideneamino)penta-1,3-dien-2-yl]propanamide |
|---|---|
| PubChem CID | 170583184 |
| Molecular Formula | C9H13FN2O |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N-[(1Z,3Z)-1-fluoro-1-(methylideneamino)penta-1,3-dien-2-yl]propanamide |
| SMILES | C=N/C(F)=C(\C=C/C)NC(=O)CC |
| InChI | InChI=1S/C9H13FN2O/c1-4-6-7(9(10)11-3)12-8(13)5-2/h4,6H,3,5H2,1-2H3,(H,12,13)/b6-4-,9-7+ |
| InChIKey | NDZPZBSNDVQQOE-UNQQQNFISA-N |
| XLogP | 1.93 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|