C42H45F2N3O4 — CID 142218030
1-[[2-(3,5-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)-N-[[(1E,3E,7E)-7-(3,4,5-trimethoxyphenyl)cycloocta-1,3,7-trien-1-yl]methyl]piperidin-4-amine (PubChem CID 142218030) has the molecular formula C42H45F2N3O4 and a molecular weight of 693.84 g/mol. Its IUPAC name is 1-[[2-(3,5-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)-N-[[(1E,3E,7E)-7-(3,4,5-trimethoxyphenyl)cycloocta-1,3,7-trien-1-yl]methyl]piperidin-4-amine.
| Compound Name | 1-[[2-(3,5-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)-N-[[(1E,3E,7E)-7-(3,4,5-trimethoxyphenyl)cycloocta-1,3,7-trien-1-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142218030 |
| Molecular Formula | C42H45F2N3O4 |
| Molecular Weight | 693.84 g/mol |
| Exact Mass | 693.34 |
| IUPAC Name | 1-[[2-(3,5-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)-N-[[(1E,3E,7E)-7-(3,4,5-trimethoxyphenyl)cycloocta-1,3,7-trien-1-yl]methyl]piperidin-4-amine |
| SMILES | COc1ccc(N(CC2=C/C=C\CC/C(c3cc(OC)c(OC)c(OC)c3)=C\2)C2CCN(Cc3ccnc(-c4cc(F)cc(F)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C42H45F2N3O4/c1-48-38-12-10-36(11-13-38)47(28-29-8-6-5-7-9-31(20-29)32-24-40(49-2)42(51-4)41(25-32)50-3)37-15-18-46(19-16-37)27-30-14-17-45-39(21-30)33-22-34(43)26-35(44)23-33/h5-6,8,10-14,17,20-26,37H,7,9,15-16,18-19,27-28H2,1-4H3/b6-5-,29-8+,31-20+ |
| InChIKey | SJUWYQVWKGFUOK-AHNKTEBUSA-N |
| XLogP | 8.89 |
| TPSA | 56.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.84 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|