C43H52N4O7 — CID 163492937
N-(4-methoxyphenyl)-N-[[6-(3,4,5-trimethoxy-4-methylcyclohexa-1,5-dien-1-yl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 163492937) has the molecular formula C43H52N4O7 and a molecular weight of 736.91 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-[[6-(3,4,5-trimethoxy-4-methylcyclohexa-1,5-dien-1-yl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-N-[[6-(3,4,5-trimethoxy-4-methylcyclohexa-1,5-dien-1-yl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 163492937 |
| Molecular Formula | C43H52N4O7 |
| Molecular Weight | 736.91 g/mol |
| Exact Mass | 736.38 |
| IUPAC Name | N-(4-methoxyphenyl)-N-[[6-(3,4,5-trimethoxy-4-methylcyclohexa-1,5-dien-1-yl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethoxyphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | COC1=CC(c2ccc(CN(c3ccc(OC)cc3)C3CCN(Cc4ccnc(-c5cc(OC)c(OC)c(OC)c5)c4)CC3)cn2)=CC(OC)C1(C)OC |
| InChI | InChI=1S/C43H52N4O7/c1-43(54-8)40(51-5)24-32(25-41(43)52-6)36-14-9-30(26-45-36)28-47(33-10-12-35(48-2)13-11-33)34-16-19-46(20-17-34)27-29-15-18-44-37(21-29)31-22-38(49-3)42(53-7)39(23-31)50-4/h9-15,18,21-26,34,40H,16-17,19-20,27-28H2,1-8H3 |
| InChIKey | COEWXWRPSADOHZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 96.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.91 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|