C26H27ClN2O3 — CID 142221191
ethane;methyl 2-[[1-[2-(3-chlorophenyl)ethyl]benzimidazol-2-yl]methoxy]benzoate (PubChem CID 142221191) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is ethane;methyl 2-[[1-[2-(3-chlorophenyl)ethyl]benzimidazol-2-yl]methoxy]benzoate.
| Compound Name | ethane;methyl 2-[[1-[2-(3-chlorophenyl)ethyl]benzimidazol-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 142221191 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | ethane;methyl 2-[[1-[2-(3-chlorophenyl)ethyl]benzimidazol-2-yl]methoxy]benzoate |
| SMILES | CC.COC(=O)c1ccccc1OCc1nc2ccccc2n1CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21ClN2O3.C2H6/c1-29-24(28)19-9-2-5-12-22(19)30-16-23-26-20-10-3-4-11-21(20)27(23)14-13-17-7-6-8-18(25)15-17;1-2/h2-12,15H,13-14,16H2,1H3;1-2H3 |
| InChIKey | AGIJXHJSJJMLDI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |