C32H27Cl3N2O2 — CID 126616638
methyl 2,2-bis(4-chlorophenyl)-2-[3-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazol-5-yl]acetate (PubChem CID 126616638) has the molecular formula C32H27Cl3N2O2 and a molecular weight of 577.94 g/mol. Its IUPAC name is methyl 2,2-bis(4-chlorophenyl)-2-[3-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazol-5-yl]acetate.
| Compound Name | methyl 2,2-bis(4-chlorophenyl)-2-[3-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazol-5-yl]acetate |
|---|---|
| PubChem CID | 126616638 |
| Molecular Formula | C32H27Cl3N2O2 |
| Molecular Weight | 577.94 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | methyl 2,2-bis(4-chlorophenyl)-2-[3-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazol-5-yl]acetate |
| SMILES | CCc1nc2ccc(C(C(=O)OC)(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2n1CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C32H27Cl3N2O2/c1-3-30-36-28-16-11-24(20-29(28)37(30)18-17-21-5-4-6-27(35)19-21)32(31(38)39-2,22-7-12-25(33)13-8-22)23-9-14-26(34)15-10-23/h4-16,19-20H,3,17-18H2,1-2H3 |
| InChIKey | DURPAILCUBFIMV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.94 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|