C32H26Cl3F3N2O2 — CID 126616362
6-[bis(4-chlorophenyl)methyl]-1-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazole;2,2,2-trifluoroacetic acid (PubChem CID 126616362) has the molecular formula C32H26Cl3F3N2O2 and a molecular weight of 633.93 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-1-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazole;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-1-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 126616362 |
| Molecular Formula | C32H26Cl3F3N2O2 |
| Molecular Weight | 633.93 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-1-[2-(3-chlorophenyl)ethyl]-2-ethylbenzimidazole;2,2,2-trifluoroacetic acid |
| SMILES | CCc1nc2ccc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2n1CCc1cccc(Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H25Cl3N2.C2HF3O2/c1-2-29-34-27-15-10-23(19-28(27)35(29)17-16-20-4-3-5-26(33)18-20)30(21-6-11-24(31)12-7-21)22-8-13-25(32)14-9-22;3-2(4,5)1(6)7/h3-15,18-19,30H,2,16-17H2,1H3;(H,6,7) |
| InChIKey | CQLPESCTFXBIAU-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.93 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|