C32H27Cl2F3N2O2 — CID 126616260
6-[bis(4-chlorophenyl)methyl]-2-methyl-1-[(2S)-2-phenylpropyl]benzimidazole;2,2,2-trifluoroacetic acid (PubChem CID 126616260) has the molecular formula C32H27Cl2F3N2O2 and a molecular weight of 599.48 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-2-methyl-1-[(2S)-2-phenylpropyl]benzimidazole;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-2-methyl-1-[(2S)-2-phenylpropyl]benzimidazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 126616260 |
| Molecular Formula | C32H27Cl2F3N2O2 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-2-methyl-1-[(2S)-2-phenylpropyl]benzimidazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc2ccc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2n1C[C@@H](C)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H26Cl2N2.C2HF3O2/c1-20(22-6-4-3-5-7-22)19-34-21(2)33-28-17-12-25(18-29(28)34)30(23-8-13-26(31)14-9-23)24-10-15-27(32)16-11-24;3-2(4,5)1(6)7/h3-18,20,30H,19H2,1-2H3;(H,6,7)/t20-;/m1./s1 |
| InChIKey | BLFGKTCLUTVGLR-VEIFNGETSA-N |
| XLogP | 9.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|