C33H24Cl2F6N2O2 — CID 140775430
[6-[bis(4-chlorophenyl)methyl]-2-ethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]benzimidazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 140775430) has the molecular formula C33H24Cl2F6N2O2 and a molecular weight of 665.46 g/mol. Its IUPAC name is [6-[bis(4-chlorophenyl)methyl]-2-ethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]benzimidazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [6-[bis(4-chlorophenyl)methyl]-2-ethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]benzimidazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140775430 |
| Molecular Formula | C33H24Cl2F6N2O2 |
| Molecular Weight | 665.46 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | [6-[bis(4-chlorophenyl)methyl]-2-ethyl-1-[2-[4-(trifluoromethyl)phenyl]ethyl]benzimidazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CCc1nc2c(OC(=O)C(F)(F)F)cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc2n1CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H24Cl2F6N2O2/c1-2-28-42-30-26(43(28)16-15-19-3-9-23(10-4-19)32(36,37)38)17-22(18-27(30)45-31(44)33(39,40)41)29(20-5-11-24(34)12-6-20)21-7-13-25(35)14-8-21/h3-14,17-18,29H,2,15-16H2,1H3 |
| InChIKey | JHFOTROFHBRVJW-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.46 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|