About acetaldehyde;1-iodo-4-methylbenzene
acetaldehyde;1-iodo-4-methylbenzene (PubChem CID 142221579) has the molecular formula C9H11IO
and a molecular weight of 262.09 g/mol. Its IUPAC name is acetaldehyde;1-iodo-4-methylbenzene.
Molecular Properties
| Compound Name | acetaldehyde;1-iodo-4-methylbenzene |
| PubChem CID | 142221579 |
| Molecular Formula | C9H11IO |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | acetaldehyde;1-iodo-4-methylbenzene |
| SMILES | CC=O.Cc1ccc(I)cc1 |
| InChI | InChI=1S/C7H7I.C2H4O/c1-6-2-4-7(8)5-3-6;1-2-3/h2-5H,1H3;2H,1H3 |
| InChIKey | VXAZKOJFBWPIPJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1-iodo-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1-iodo-4-methylbenzene?
The IUPAC name of acetaldehyde;1-iodo-4-methylbenzene (CID 142221579) is acetaldehyde;1-iodo-4-methylbenzene.
What is the SMILES notation for acetaldehyde;1-iodo-4-methylbenzene?
The canonical SMILES for acetaldehyde;1-iodo-4-methylbenzene is CC=O.Cc1ccc(I)cc1.
What is the InChIKey of acetaldehyde;1-iodo-4-methylbenzene?
The InChIKey is VXAZKOJFBWPIPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7I.C2H4O/c1-6-2-4-7(8)5-3-6;1-2-3/h2-5H,1H3;2H,1H3.
What are the key properties of acetaldehyde;1-iodo-4-methylbenzene?
acetaldehyde;1-iodo-4-methylbenzene has a molecular weight of 262.09 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1-iodo-4-methylbenzene is sourced from PubChem (CID 142221579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).