C7H6Cl2O — CID 142221757
2,6-dichlorocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 142221757) has the molecular formula C7H6Cl2O and a molecular weight of 177.03 g/mol. Its IUPAC name is 2,6-dichlorocyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 2,6-dichlorocyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 142221757 |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | 2,6-dichlorocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | O=CC1=C(Cl)CCC=C1Cl |
| InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-3-7(9)5(6)4-10/h2,4H,1,3H2 |
| InChIKey | HAQUADYSPSZLTO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|