C10H16Cl2 — CID 167701959
1,3-dichloro-2-propylcyclohexa-1,3-diene;methane (PubChem CID 167701959) has the molecular formula C10H16Cl2 and a molecular weight of 207.14 g/mol. Its IUPAC name is 1,3-dichloro-2-propylcyclohexa-1,3-diene;methane.
| Compound Name | 1,3-dichloro-2-propylcyclohexa-1,3-diene;methane |
|---|---|
| PubChem CID | 167701959 |
| Molecular Formula | C10H16Cl2 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 1,3-dichloro-2-propylcyclohexa-1,3-diene;methane |
| SMILES | C.CCCC1=C(Cl)CCC=C1Cl |
| InChI | InChI=1S/C9H12Cl2.CH4/c1-2-4-7-8(10)5-3-6-9(7)11;/h5H,2-4,6H2,1H3;1H4 |
| InChIKey | YNHAZIHOSLXPNK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |