C13H17N — CID 145028183
1-(5-propylcyclohexa-1,5-dien-1-yl)pyrrole (PubChem CID 145028183) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-(5-propylcyclohexa-1,5-dien-1-yl)pyrrole.
| Compound Name | 1-(5-propylcyclohexa-1,5-dien-1-yl)pyrrole |
|---|---|
| PubChem CID | 145028183 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-(5-propylcyclohexa-1,5-dien-1-yl)pyrrole |
| SMILES | CCCC1=CC(n2cccc2)=CCC1 |
| InChI | InChI=1S/C13H17N/c1-2-6-12-7-5-8-13(11-12)14-9-3-4-10-14/h3-4,8-11H,2,5-7H2,1H3 |
| InChIKey | VKKVNASRTSNHAZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |