C24H27NO — CID 142222323
1-[2-(4-ethenylphenyl)ethynyl]-N-[(4-methoxyphenyl)methyl]cyclohexan-1-amine (PubChem CID 142222323) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-[2-(4-ethenylphenyl)ethynyl]-N-[(4-methoxyphenyl)methyl]cyclohexan-1-amine.
| Compound Name | 1-[2-(4-ethenylphenyl)ethynyl]-N-[(4-methoxyphenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 142222323 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-[2-(4-ethenylphenyl)ethynyl]-N-[(4-methoxyphenyl)methyl]cyclohexan-1-amine |
| SMILES | C=Cc1ccc(C#CC2(NCc3ccc(OC)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C24H27NO/c1-3-20-7-9-21(10-8-20)15-18-24(16-5-4-6-17-24)25-19-22-11-13-23(26-2)14-12-22/h3,7-14,25H,1,4-6,16-17,19H2,2H3 |
| InChIKey | RTCBAAOGUGQFBZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|